About 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate
2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate (PubChem CID 175432632) has the molecular formula C14H11BrF2N4O3
and a molecular weight of 401.17 g/mol. Its IUPAC name is 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate.
Molecular Properties
| Compound Name | 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate |
| PubChem CID | 175432632 |
| Molecular Formula | C14H11BrF2N4O3 |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate |
| SMILES | Cn1c(=O)n(CCOC(N)=O)c2c3c(F)c(Br)c(F)cc3ncc21 |
| InChI | InChI=1S/C14H11BrF2N4O3/c1-20-8-5-19-7-4-6(16)10(15)11(17)9(7)12(8)21(14(20)23)2-3-24-13(18)22/h4-5H,2-3H2,1H3,(H2,18,22) |
| InChIKey | KPRXZYIOOIYYSK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate?
The IUPAC name of 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate (CID 175432632) is 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate.
What is the SMILES notation for 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate?
The canonical SMILES for 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate is Cn1c(=O)n(CCOC(N)=O)c2c3c(F)c(Br)c(F)cc3ncc21.
What is the InChIKey of 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate?
The InChIKey is KPRXZYIOOIYYSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrF2N4O3/c1-20-8-5-19-7-4-6(16)10(15)11(17)9(7)12(8)21(14(20)23)2-3-24-13(18)22/h4-5H,2-3H2,1H3,(H2,18,22).
What are the key properties of 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate?
2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate has a molecular weight of 401.17 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-bromo-7,9-difluoro-3-methyl-2-oxoimidazo[4,5-c]quinolin-1-yl)ethyl carbamate is sourced from PubChem (CID 175432632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).