C22H28O2 — CID 175432888
bicyclo[2.2.2]octa-1,3,5-triene;1-(1-ethoxy-3-methylbut-3-enyl)-4-methoxybenzene (PubChem CID 175432888) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is bicyclo[2.2.2]octa-1,3,5-triene;1-(1-ethoxy-3-methylbut-3-enyl)-4-methoxybenzene.
| Compound Name | bicyclo[2.2.2]octa-1,3,5-triene;1-(1-ethoxy-3-methylbut-3-enyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 175432888 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | bicyclo[2.2.2]octa-1,3,5-triene;1-(1-ethoxy-3-methylbut-3-enyl)-4-methoxybenzene |
| SMILES | C=C(C)CC(OCC)c1ccc(OC)cc1.c1cc2ccc1CC2 |
| InChI | InChI=1S/C14H20O2.C8H8/c1-5-16-14(10-11(2)3)12-6-8-13(15-4)9-7-12;1-2-8-5-3-7(1)4-6-8/h6-9,14H,2,5,10H2,1,3-4H3;1-3,5H,4,6H2 |
| InChIKey | UIMFZQXJSISIBG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|