C26H23ClN2O5 — CID 175433013
methyl 2-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]benzoate (PubChem CID 175433013) has the molecular formula C26H23ClN2O5 and a molecular weight of 478.93 g/mol. Its IUPAC name is methyl 2-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]benzoate.
| Compound Name | methyl 2-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]benzoate |
|---|---|
| PubChem CID | 175433013 |
| Molecular Formula | C26H23ClN2O5 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl 2-chloro-4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(C)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1Cl |
| InChI | InChI=1S/C26H23ClN2O5/c1-15(24(30)29-16-11-12-21(23(27)13-16)25(31)33-2)28-26(32)34-14-22-19-9-5-3-7-17(19)18-8-4-6-10-20(18)22/h3-13,15,22H,14H2,1-2H3,(H,28,32)(H,29,30) |
| InChIKey | ZKAACUDBPJAZCK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |