C25H36BrFIN3O3 — CID 175433440
tert-butyl N-[(2S)-1-[(4-bromo-6-fluoro-5-iodo-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate (PubChem CID 175433440) has the molecular formula C25H36BrFIN3O3 and a molecular weight of 652.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(4-bromo-6-fluoro-5-iodo-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(4-bromo-6-fluoro-5-iodo-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175433440 |
| Molecular Formula | C25H36BrFIN3O3 |
| Molecular Weight | 652.39 g/mol |
| Exact Mass | 651.10 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(4-bromo-6-fluoro-5-iodo-2-pyridinyl)amino]-3,3-dicyclohexyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)Nc1cc(Br)c(I)c(F)n1)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H36BrFIN3O3/c1-25(2,3)34-24(33)31-21(23(32)30-18-14-17(26)20(28)22(27)29-18)19(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h14-16,19,21H,4-13H2,1-3H3,(H,31,33)(H,29,30,32)/t21-/m0/s1 |
| InChIKey | WWGJEBODXVXFPG-NRFANRHFSA-N |
| XLogP | 7.20 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.39 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|