About oxalonitrile;2,3,4,5-tetrachloropyridine
oxalonitrile;2,3,4,5-tetrachloropyridine (PubChem CID 175434253) has the molecular formula C7HCl4N3
and a molecular weight of 268.92 g/mol. Its IUPAC name is oxalonitrile;2,3,4,5-tetrachloropyridine.
Molecular Properties
| Compound Name | oxalonitrile;2,3,4,5-tetrachloropyridine |
| PubChem CID | 175434253 |
| Molecular Formula | C7HCl4N3 |
| Molecular Weight | 268.92 g/mol |
| Exact Mass | 266.89 |
| IUPAC Name | oxalonitrile;2,3,4,5-tetrachloropyridine |
| SMILES | Clc1cnc(Cl)c(Cl)c1Cl.N#CC#N |
| InChI | InChI=1S/C5HCl4N.C2N2/c6-2-1-10-5(9)4(8)3(2)7;3-1-2-4/h1H; |
| InChIKey | DMWJYBWYJPGONP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze oxalonitrile;2,3,4,5-tetrachloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalonitrile;2,3,4,5-tetrachloropyridine?
The IUPAC name of oxalonitrile;2,3,4,5-tetrachloropyridine (CID 175434253) is oxalonitrile;2,3,4,5-tetrachloropyridine.
What is the SMILES notation for oxalonitrile;2,3,4,5-tetrachloropyridine?
The canonical SMILES for oxalonitrile;2,3,4,5-tetrachloropyridine is Clc1cnc(Cl)c(Cl)c1Cl.N#CC#N.
What is the InChIKey of oxalonitrile;2,3,4,5-tetrachloropyridine?
The InChIKey is DMWJYBWYJPGONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HCl4N.C2N2/c6-2-1-10-5(9)4(8)3(2)7;3-1-2-4/h1H;.
What are the key properties of oxalonitrile;2,3,4,5-tetrachloropyridine?
oxalonitrile;2,3,4,5-tetrachloropyridine has a molecular weight of 268.92 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxalonitrile;2,3,4,5-tetrachloropyridine is sourced from PubChem (CID 175434253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).