About 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid
2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid (PubChem CID 175434618) has the molecular formula C8H13NO4
and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid |
| PubChem CID | 175434618 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid |
| SMILES | COC(C)C(C(=O)O)C1=NCCO1 |
| InChI | InChI=1S/C8H13NO4/c1-5(12-2)6(8(10)11)7-9-3-4-13-7/h5-6H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | AUDVHYUVIZMUKQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid?
The IUPAC name of 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid (CID 175434618) is 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid.
What is the SMILES notation for 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid?
The canonical SMILES for 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid is COC(C)C(C(=O)O)C1=NCCO1.
What is the InChIKey of 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid?
The InChIKey is AUDVHYUVIZMUKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4/c1-5(12-2)6(8(10)11)7-9-3-4-13-7/h5-6H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid?
2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid has a molecular weight of 187.19 g/mol, XLogP of 0.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1,3-oxazol-2-yl)-3-methoxybutanoic acid is sourced from PubChem (CID 175434618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).