C9H10F8 — CID 175434745
1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene;hydrofluoride (PubChem CID 175434745) has the molecular formula C9H10F8 and a molecular weight of 270.16 g/mol. Its IUPAC name is 1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene;hydrofluoride.
| Compound Name | 1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene;hydrofluoride |
|---|---|
| PubChem CID | 175434745 |
| Molecular Formula | C9H10F8 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene;hydrofluoride |
| SMILES | CC(C)(C)C1=C(F)C(F)(F)C(F)(F)C1(F)F.F |
| InChI | InChI=1S/C9H9F7.FH/c1-6(2,3)4-5(10)8(13,14)9(15,16)7(4,11)12;/h1-3H3;1H |
| InChIKey | VNMJXLHTZSDZSL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|