About lithium;3-ethylideneoxolane-2,5-dione;hydride
lithium;3-ethylideneoxolane-2,5-dione;hydride (PubChem CID 175434916) has the molecular formula C6H7LiO3
and a molecular weight of 134.06 g/mol. Its IUPAC name is lithium;3-ethylideneoxolane-2,5-dione;hydride.
Molecular Properties
| Compound Name | lithium;3-ethylideneoxolane-2,5-dione;hydride |
| PubChem CID | 175434916 |
| Molecular Formula | C6H7LiO3 |
| Molecular Weight | 134.06 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | lithium;3-ethylideneoxolane-2,5-dione;hydride |
| SMILES | CC=C1CC(=O)OC1=O.[H-].[Li+] |
| InChI | InChI=1S/C6H6O3.Li.H/c1-2-4-3-5(7)9-6(4)8;;/h2H,3H2,1H3;;/q;+1;-1 |
| InChIKey | ZBOAEYVMBPZDIA-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.06 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;3-ethylideneoxolane-2,5-dione;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;3-ethylideneoxolane-2,5-dione;hydride?
The IUPAC name of lithium;3-ethylideneoxolane-2,5-dione;hydride (CID 175434916) is lithium;3-ethylideneoxolane-2,5-dione;hydride.
What is the SMILES notation for lithium;3-ethylideneoxolane-2,5-dione;hydride?
The canonical SMILES for lithium;3-ethylideneoxolane-2,5-dione;hydride is CC=C1CC(=O)OC1=O.[H-].[Li+].
What is the InChIKey of lithium;3-ethylideneoxolane-2,5-dione;hydride?
The InChIKey is ZBOAEYVMBPZDIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3.Li.H/c1-2-4-3-5(7)9-6(4)8;;/h2H,3H2,1H3;;/q;+1;-1.
What are the key properties of lithium;3-ethylideneoxolane-2,5-dione;hydride?
lithium;3-ethylideneoxolane-2,5-dione;hydride has a molecular weight of 134.06 g/mol, XLogP of -2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;3-ethylideneoxolane-2,5-dione;hydride is sourced from PubChem (CID 175434916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).