C18H24F3N5O2 — CID 175435457
methyl 2-[5-[2-(2-methylazetidin-1-yl)-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate (PubChem CID 175435457) has the molecular formula C18H24F3N5O2 and a molecular weight of 399.42 g/mol. Its IUPAC name is methyl 2-[5-[2-(2-methylazetidin-1-yl)-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate.
| Compound Name | methyl 2-[5-[2-(2-methylazetidin-1-yl)-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 175435457 |
| Molecular Formula | C18H24F3N5O2 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | methyl 2-[5-[2-(2-methylazetidin-1-yl)-6-(trifluoromethyl)pyrimidin-4-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]acetate |
| SMILES | COC(=O)CN1CC2CN(c3cc(C(F)(F)F)nc(N4CCC4C)n3)CC2C1 |
| InChI | InChI=1S/C18H24F3N5O2/c1-11-3-4-26(11)17-22-14(18(19,20)21)5-15(23-17)25-8-12-6-24(7-13(12)9-25)10-16(27)28-2/h5,11-13H,3-4,6-10H2,1-2H3 |
| InChIKey | AZOLCWSVXKNSLP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |