About boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene
boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene (PubChem CID 175435744) has the molecular formula C14H24BFO5
and a molecular weight of 302.15 g/mol. Its IUPAC name is boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene.
Molecular Properties
| Compound Name | boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene |
| PubChem CID | 175435744 |
| Molecular Formula | C14H24BFO5 |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene |
| SMILES | C=Cc1ccccc1F.CC(C)(O)C(C)(C)O.OB(O)O |
| InChI | InChI=1S/C8H7F.C6H14O2.BH3O3/c1-2-7-5-3-4-6-8(7)9;1-5(2,7)6(3,4)8;2-1(3)4/h2-6H,1H2;7-8H,1-4H3;2-4H |
| InChIKey | GJCDPNWYRAZWMW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene?
The IUPAC name of boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene (CID 175435744) is boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene.
What is the SMILES notation for boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene?
The canonical SMILES for boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene is C=Cc1ccccc1F.CC(C)(O)C(C)(C)O.OB(O)O.
What is the InChIKey of boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene?
The InChIKey is GJCDPNWYRAZWMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F.C6H14O2.BH3O3/c1-2-7-5-3-4-6-8(7)9;1-5(2,7)6(3,4)8;2-1(3)4/h2-6H,1H2;7-8H,1-4H3;2-4H.
What are the key properties of boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene?
boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene has a molecular weight of 302.15 g/mol, XLogP of 0.95, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;2,3-dimethylbutane-2,3-diol;1-ethenyl-2-fluorobenzene is sourced from PubChem (CID 175435744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).