About 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile
2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile (PubChem CID 175435865) has the molecular formula C15H13F2N
and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile |
| PubChem CID | 175435865 |
| Molecular Formula | C15H13F2N |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile |
| SMILES | CC1C=CC=CC1(CC#N)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F2N/c1-11-4-2-3-7-15(11,8-9-18)13-6-5-12(16)10-14(13)17/h2-7,10-11H,8H2,1H3 |
| InChIKey | WIUWVHOCHBOPPR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile?
The IUPAC name of 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile (CID 175435865) is 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile.
What is the SMILES notation for 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile?
The canonical SMILES for 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile is CC1C=CC=CC1(CC#N)c1ccc(F)cc1F.
What is the InChIKey of 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile?
The InChIKey is WIUWVHOCHBOPPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N/c1-11-4-2-3-7-15(11,8-9-18)13-6-5-12(16)10-14(13)17/h2-7,10-11H,8H2,1H3.
What are the key properties of 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile?
2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile has a molecular weight of 245.27 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-difluorophenyl)-6-methylcyclohexa-2,4-dien-1-yl]acetonitrile is sourced from PubChem (CID 175435865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).