About (5-hexylthiophen-2-yl) carbonochloridate
(5-hexylthiophen-2-yl) carbonochloridate (PubChem CID 175435887) has the molecular formula C11H15ClO2S
and a molecular weight of 246.76 g/mol. Its IUPAC name is (5-hexylthiophen-2-yl) carbonochloridate.
Molecular Properties
| Compound Name | (5-hexylthiophen-2-yl) carbonochloridate |
| PubChem CID | 175435887 |
| Molecular Formula | C11H15ClO2S |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (5-hexylthiophen-2-yl) carbonochloridate |
| SMILES | CCCCCCc1ccc(OC(=O)Cl)s1 |
| InChI | InChI=1S/C11H15ClO2S/c1-2-3-4-5-6-9-7-8-10(15-9)14-11(12)13/h7-8H,2-6H2,1H3 |
| InChIKey | JKJFDMBYHFCARF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-hexylthiophen-2-yl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hexylthiophen-2-yl) carbonochloridate?
The IUPAC name of (5-hexylthiophen-2-yl) carbonochloridate (CID 175435887) is (5-hexylthiophen-2-yl) carbonochloridate.
What is the SMILES notation for (5-hexylthiophen-2-yl) carbonochloridate?
The canonical SMILES for (5-hexylthiophen-2-yl) carbonochloridate is CCCCCCc1ccc(OC(=O)Cl)s1.
What is the InChIKey of (5-hexylthiophen-2-yl) carbonochloridate?
The InChIKey is JKJFDMBYHFCARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO2S/c1-2-3-4-5-6-9-7-8-10(15-9)14-11(12)13/h7-8H,2-6H2,1H3.
What are the key properties of (5-hexylthiophen-2-yl) carbonochloridate?
(5-hexylthiophen-2-yl) carbonochloridate has a molecular weight of 246.76 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hexylthiophen-2-yl) carbonochloridate is sourced from PubChem (CID 175435887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).