C17H31NO2 — CID 175436009
1,4-bis[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 175436009) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 1,4-bis[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1,4-bis[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 175436009 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 1,4-bis[(E)-but-2-enoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | C/C=C/COC1CC(C)(C)N(OC/C=C/C)C(C)(C)C1 |
| InChI | InChI=1S/C17H31NO2/c1-7-9-11-19-15-13-16(3,4)18(17(5,6)14-15)20-12-10-8-2/h7-10,15H,11-14H2,1-6H3/b9-7+,10-8+ |
| InChIKey | CMEBVWZRLJEEEK-FIFLTTCUSA-N |
| XLogP | 4.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|