C26H42O2 — CID 175436132
4-[2-[2-methyl-3,3-bis(prop-2-enyl)hex-5-en-2-yl]peroxypropan-2-yl]-4-prop-2-enylhepta-1,6-diene (PubChem CID 175436132) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 4-[2-[2-methyl-3,3-bis(prop-2-enyl)hex-5-en-2-yl]peroxypropan-2-yl]-4-prop-2-enylhepta-1,6-diene.
| Compound Name | 4-[2-[2-methyl-3,3-bis(prop-2-enyl)hex-5-en-2-yl]peroxypropan-2-yl]-4-prop-2-enylhepta-1,6-diene |
|---|---|
| PubChem CID | 175436132 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 4-[2-[2-methyl-3,3-bis(prop-2-enyl)hex-5-en-2-yl]peroxypropan-2-yl]-4-prop-2-enylhepta-1,6-diene |
| SMILES | C=CCC(CC=C)(CC=C)C(C)(C)OOC(C)(C)C(CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C26H42O2/c1-11-17-25(18-12-2,19-13-3)23(7,8)27-28-24(9,10)26(20-14-4,21-15-5)22-16-6/h11-16H,1-6,17-22H2,7-10H3 |
| InChIKey | WYISOZUBNUHILD-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|