About formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate
formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate (PubChem CID 175437573) has the molecular formula C22H18O4S
and a molecular weight of 378.45 g/mol. Its IUPAC name is formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate |
| PubChem CID | 175437573 |
| Molecular Formula | C22H18O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate |
| SMILES | C=C1C=Cc2ccccc2C1S(=O)(=O)Oc1cccc2ccccc12.C=O |
| InChI | InChI=1S/C21H16O3S.CH2O/c1-15-13-14-17-8-3-5-11-19(17)21(15)25(22,23)24-20-12-6-9-16-7-2-4-10-18(16)20;1-2/h2-14,21H,1H2;1H2 |
| InChIKey | HLHGLNOXWIXURX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate?
The IUPAC name of formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate (CID 175437573) is formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate.
What is the SMILES notation for formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate?
The canonical SMILES for formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate is C=C1C=Cc2ccccc2C1S(=O)(=O)Oc1cccc2ccccc12.C=O.
What is the InChIKey of formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate?
The InChIKey is HLHGLNOXWIXURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O3S.CH2O/c1-15-13-14-17-8-3-5-11-19(17)21(15)25(22,23)24-20-12-6-9-16-7-2-4-10-18(16)20;1-2/h2-14,21H,1H2;1H2.
What are the key properties of formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate?
formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate has a molecular weight of 378.45 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;naphthalen-1-yl 2-methylidene-1H-naphthalene-1-sulfonate is sourced from PubChem (CID 175437573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).