About N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine
N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine (PubChem CID 175437898) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine.
Molecular Properties
| Compound Name | N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine |
| PubChem CID | 175437898 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine |
| SMILES | C=Cc1ccccc1N=C=NC1CCCCC1 |
| InChI | InChI=1S/C15H18N2/c1-2-13-8-6-7-11-15(13)17-12-16-14-9-4-3-5-10-14/h2,6-8,11,14H,1,3-5,9-10H2 |
| InChIKey | KZNLYOUJXYGAMG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine?
The IUPAC name of N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine (CID 175437898) is N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine.
What is the SMILES notation for N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine?
The canonical SMILES for N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine is C=Cc1ccccc1N=C=NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine?
The InChIKey is KZNLYOUJXYGAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2/c1-2-13-8-6-7-11-15(13)17-12-16-14-9-4-3-5-10-14/h2,6-8,11,14H,1,3-5,9-10H2.
What are the key properties of N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine?
N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine has a molecular weight of 226.32 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N'-(2-ethenylphenyl)methanediimine is sourced from PubChem (CID 175437898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).