About acetyl 2-fluoroacetate;but-2-ynoic acid
acetyl 2-fluoroacetate;but-2-ynoic acid (PubChem CID 175438122) has the molecular formula C8H9FO5
and a molecular weight of 204.15 g/mol. Its IUPAC name is acetyl 2-fluoroacetate;but-2-ynoic acid.
Molecular Properties
| Compound Name | acetyl 2-fluoroacetate;but-2-ynoic acid |
| PubChem CID | 175438122 |
| Molecular Formula | C8H9FO5 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | acetyl 2-fluoroacetate;but-2-ynoic acid |
| SMILES | CC#CC(=O)O.CC(=O)OC(=O)CF |
| InChI | InChI=1S/C4H5FO3.C4H4O2/c1-3(6)8-4(7)2-5;1-2-3-4(5)6/h2H2,1H3;1H3,(H,5,6) |
| InChIKey | FOXLNTQPQRPVMH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyl 2-fluoroacetate;but-2-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 2-fluoroacetate;but-2-ynoic acid?
The IUPAC name of acetyl 2-fluoroacetate;but-2-ynoic acid (CID 175438122) is acetyl 2-fluoroacetate;but-2-ynoic acid.
What is the SMILES notation for acetyl 2-fluoroacetate;but-2-ynoic acid?
The canonical SMILES for acetyl 2-fluoroacetate;but-2-ynoic acid is CC#CC(=O)O.CC(=O)OC(=O)CF.
What is the InChIKey of acetyl 2-fluoroacetate;but-2-ynoic acid?
The InChIKey is FOXLNTQPQRPVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FO3.C4H4O2/c1-3(6)8-4(7)2-5;1-2-3-4(5)6/h2H2,1H3;1H3,(H,5,6).
What are the key properties of acetyl 2-fluoroacetate;but-2-ynoic acid?
acetyl 2-fluoroacetate;but-2-ynoic acid has a molecular weight of 204.15 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 2-fluoroacetate;but-2-ynoic acid is sourced from PubChem (CID 175438122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).