C6H10N2O2S — CID 175438345
1,3,5,6,7,7a-hexahydroimidazo[1,5-c][1,3]thiazole-7-carboxylic acid (PubChem CID 175438345) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is 1,3,5,6,7,7a-hexahydroimidazo[1,5-c][1,3]thiazole-7-carboxylic acid.
| Compound Name | 1,3,5,6,7,7a-hexahydroimidazo[1,5-c][1,3]thiazole-7-carboxylic acid |
|---|---|
| PubChem CID | 175438345 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 1,3,5,6,7,7a-hexahydroimidazo[1,5-c][1,3]thiazole-7-carboxylic acid |
| SMILES | O=C(O)C1NCN2CSCC12 |
| InChI | InChI=1S/C6H10N2O2S/c9-6(10)5-4-1-11-3-8(4)2-7-5/h4-5,7H,1-3H2,(H,9,10) |
| InChIKey | OCOQMPRALOIBRM-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |