About 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride
2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride (PubChem CID 175438456) has the molecular formula C14H22Cl4O2S2Si
and a molecular weight of 456.36 g/mol. Its IUPAC name is 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride |
| PubChem CID | 175438456 |
| Molecular Formula | C14H22Cl4O2S2Si |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride |
| SMILES | CC(C)SC(C)C.O=S(=O)(Cl)c1ccccc1CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H8Cl4O2SSi.C6H14S/c9-15(13,14)8-4-2-1-3-7(8)5-6-16(10,11)12;1-5(2)7-6(3)4/h1-4H,5-6H2;5-6H,1-4H3 |
| InChIKey | LDDMTTHSUKYGTN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride?
The IUPAC name of 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride (CID 175438456) is 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride.
What is the SMILES notation for 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride?
The canonical SMILES for 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride is CC(C)SC(C)C.O=S(=O)(Cl)c1ccccc1CC[Si](Cl)(Cl)Cl.
What is the InChIKey of 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride?
The InChIKey is LDDMTTHSUKYGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl4O2SSi.C6H14S/c9-15(13,14)8-4-2-1-3-7(8)5-6-16(10,11)12;1-5(2)7-6(3)4/h1-4H,5-6H2;5-6H,1-4H3.
What are the key properties of 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride?
2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride has a molecular weight of 456.36 g/mol, XLogP of 6.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylsulfanylpropane;2-(2-trichlorosilylethyl)benzenesulfonyl chloride is sourced from PubChem (CID 175438456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).