About tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate
tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 175438688) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate |
| PubChem CID | 175438688 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2nccs2)=CC1CO |
| InChI | InChI=1S/C13H18N2O3S/c1-13(2,3)18-12(17)15-7-9(6-10(15)8-16)11-14-4-5-19-11/h4-6,10,16H,7-8H2,1-3H3 |
| InChIKey | YKXKOPZXIVDSRO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate?
The IUPAC name of tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate (CID 175438688) is tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate.
What is the SMILES notation for tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate?
The canonical SMILES for tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate is CC(C)(C)OC(=O)N1CC(c2nccs2)=CC1CO.
What is the InChIKey of tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate?
The InChIKey is YKXKOPZXIVDSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-13(2,3)18-12(17)15-7-9(6-10(15)8-16)11-14-4-5-19-11/h4-6,10,16H,7-8H2,1-3H3.
What are the key properties of tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate?
tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate has a molecular weight of 282.36 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(hydroxymethyl)-4-(1,3-thiazol-2-yl)-2,5-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 175438688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).