C30H28ClF3N2O6 — CID 175439796
ethyl 3-[[3-[[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)indol-1-yl]ethyl]amino]-5-methoxyphenyl]methoxy]propanoate (PubChem CID 175439796) has the molecular formula C30H28ClF3N2O6 and a molecular weight of 605.01 g/mol. Its IUPAC name is ethyl 3-[[3-[[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)indol-1-yl]ethyl]amino]-5-methoxyphenyl]methoxy]propanoate.
| Compound Name | ethyl 3-[[3-[[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)indol-1-yl]ethyl]amino]-5-methoxyphenyl]methoxy]propanoate |
|---|---|
| PubChem CID | 175439796 |
| Molecular Formula | C30H28ClF3N2O6 |
| Molecular Weight | 605.01 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | ethyl 3-[[3-[[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)indol-1-yl]ethyl]amino]-5-methoxyphenyl]methoxy]propanoate |
| SMILES | CCOC(=O)CCOCc1cc(NC(C(=O)n2ccc3ccc(OC(F)(F)F)cc32)c2ccc(Cl)cc2)cc(OC)c1 |
| InChI | InChI=1S/C30H28ClF3N2O6/c1-3-41-27(37)11-13-40-18-19-14-23(16-25(15-19)39-2)35-28(21-4-7-22(31)8-5-21)29(38)36-12-10-20-6-9-24(17-26(20)36)42-30(32,33)34/h4-10,12,14-17,28,35H,3,11,13,18H2,1-2H3 |
| InChIKey | DMCFLDUQHHDFHY-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.01 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|