C18H26N2O2 — CID 175440164
4,4,5,6,7,8-hexamethyl-2,3-dihydro-1H-naphthalene-1,2-dicarboxamide (PubChem CID 175440164) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4,4,5,6,7,8-hexamethyl-2,3-dihydro-1H-naphthalene-1,2-dicarboxamide.
| Compound Name | 4,4,5,6,7,8-hexamethyl-2,3-dihydro-1H-naphthalene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 175440164 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 4,4,5,6,7,8-hexamethyl-2,3-dihydro-1H-naphthalene-1,2-dicarboxamide |
| SMILES | Cc1c(C)c(C)c2c(c1C)C(C(N)=O)C(C(N)=O)CC2(C)C |
| InChI | InChI=1S/C18H26N2O2/c1-8-9(2)11(4)15-13(10(8)3)14(17(20)22)12(16(19)21)7-18(15,5)6/h12,14H,7H2,1-6H3,(H2,19,21)(H2,20,22) |
| InChIKey | NWBPVOXRFAKONX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |