C15H35N3 — CID 175440948
hexane-1,6-diamine;1,2,2,3-tetramethylpiperidine (PubChem CID 175440948) has the molecular formula C15H35N3 and a molecular weight of 257.47 g/mol. Its IUPAC name is hexane-1,6-diamine;1,2,2,3-tetramethylpiperidine.
| Compound Name | hexane-1,6-diamine;1,2,2,3-tetramethylpiperidine |
|---|---|
| PubChem CID | 175440948 |
| Molecular Formula | C15H35N3 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.28 |
| IUPAC Name | hexane-1,6-diamine;1,2,2,3-tetramethylpiperidine |
| SMILES | CC1CCCN(C)C1(C)C.NCCCCCCN |
| InChI | InChI=1S/C9H19N.C6H16N2/c1-8-6-5-7-10(4)9(8,2)3;7-5-3-1-2-4-6-8/h8H,5-7H2,1-4H3;1-8H2 |
| InChIKey | ZAUNTMSAMKRXBD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|