About (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid
(4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid (PubChem CID 175441015) has the molecular formula C15H11ClF3NO5S
and a molecular weight of 409.77 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid.
Molecular Properties
| Compound Name | (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid |
| PubChem CID | 175441015 |
| Molecular Formula | C15H11ClF3NO5S |
| Molecular Weight | 409.77 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid |
| SMILES | CCOC(=O)c1ccc(N(c2cc(F)c(Cl)cc2F)S(=O)(=O)O)c(F)c1 |
| InChI | InChI=1S/C15H11ClF3NO5S/c1-2-25-15(21)8-3-4-13(11(18)5-8)20(26(22,23)24)14-7-10(17)9(16)6-12(14)19/h3-7H,2H2,1H3,(H,22,23,24) |
| InChIKey | KGKJSLYMUBFIOM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.77 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid?
The IUPAC name of (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid (CID 175441015) is (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid.
What is the SMILES notation for (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid?
The canonical SMILES for (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid is CCOC(=O)c1ccc(N(c2cc(F)c(Cl)cc2F)S(=O)(=O)O)c(F)c1.
What is the InChIKey of (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid?
The InChIKey is KGKJSLYMUBFIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClF3NO5S/c1-2-25-15(21)8-3-4-13(11(18)5-8)20(26(22,23)24)14-7-10(17)9(16)6-12(14)19/h3-7H,2H2,1H3,(H,22,23,24).
What are the key properties of (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid?
(4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid has a molecular weight of 409.77 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2,5-difluorophenyl)-(4-ethoxycarbonyl-2-fluorophenyl)sulfamic acid is sourced from PubChem (CID 175441015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).