About 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine
2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine (PubChem CID 175441062) has the molecular formula C15H19N3S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine |
| PubChem CID | 175441062 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine |
| SMILES | C/N=c1\nc(-c2ccccc2)n(C2CCCCC2)s1 |
| InChI | InChI=1S/C15H19N3S/c1-16-15-17-14(12-8-4-2-5-9-12)18(19-15)13-10-6-3-7-11-13/h2,4-5,8-9,13H,3,6-7,10-11H2,1H3/b16-15+ |
| InChIKey | JLGWSZMENLDCNK-FOCLMDBBSA-N |
| XLogP | 3.65 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
The IUPAC name of 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine (CID 175441062) is 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine.
What is the SMILES notation for 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
The canonical SMILES for 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine is C/N=c1\nc(-c2ccccc2)n(C2CCCCC2)s1.
What is the InChIKey of 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
The InChIKey is JLGWSZMENLDCNK-FOCLMDBBSA-N. The full InChI is InChI=1S/C15H19N3S/c1-16-15-17-14(12-8-4-2-5-9-12)18(19-15)13-10-6-3-7-11-13/h2,4-5,8-9,13H,3,6-7,10-11H2,1H3/b16-15+.
What are the key properties of 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine has a molecular weight of 273.40 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-methyl-3-phenyl-1,2,4-thiadiazol-5-imine is sourced from PubChem (CID 175441062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).