C13H15BN2O3 — CID 175441158
7-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylquinoxalin-2-one (PubChem CID 175441158) has the molecular formula C13H15BN2O3 and a molecular weight of 258.09 g/mol. Its IUPAC name is 7-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylquinoxalin-2-one.
| Compound Name | 7-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylquinoxalin-2-one |
|---|---|
| PubChem CID | 175441158 |
| Molecular Formula | C13H15BN2O3 |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 7-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1-methylquinoxalin-2-one |
| SMILES | Cn1c(=O)cnc2ccc(B3OCC(C)(C)O3)cc21 |
| InChI | InChI=1S/C13H15BN2O3/c1-13(2)8-18-14(19-13)9-4-5-10-11(6-9)16(3)12(17)7-15-10/h4-7H,8H2,1-3H3 |
| InChIKey | LFCVQTHXPHYNTB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|