C19H36O6 — CID 175441647
butane-1,4-diol;4-oxopentanoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 175441647) has the molecular formula C19H36O6 and a molecular weight of 360.49 g/mol. Its IUPAC name is butane-1,4-diol;4-oxopentanoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | butane-1,4-diol;4-oxopentanoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 175441647 |
| Molecular Formula | C19H36O6 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | butane-1,4-diol;4-oxopentanoic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC(=O)CCC(=O)O.CC1(C)C2CCC1(C)C(O)C2.OCCCCO |
| InChI | InChI=1S/C10H18O.C5H8O3.C4H10O2/c1-9(2)7-4-5-10(9,3)8(11)6-7;1-4(6)2-3-5(7)8;5-3-1-2-4-6/h7-8,11H,4-6H2,1-3H3;2-3H2,1H3,(H,7,8);5-6H,1-4H2 |
| InChIKey | XSGRXHWKARJEQM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|