About bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol
bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol (PubChem CID 175441763) has the molecular formula C9H8O
and a molecular weight of 132.16 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol |
| PubChem CID | 175441763 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol |
| SMILES | C#CCO.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.C3H4O/c1-2-6-4-3-5(1)6;1-2-3-4/h1-4H;1,4H,3H2 |
| InChIKey | LRPVDQVLPJXQQN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol (CID 175441763) is bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol is C#CCO.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol?
The InChIKey is LRPVDQVLPJXQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C3H4O/c1-2-6-4-3-5(1)6;1-2-3-4/h1-4H;1,4H,3H2.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol?
bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol has a molecular weight of 132.16 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;prop-2-yn-1-ol is sourced from PubChem (CID 175441763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).