About ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate
ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate (PubChem CID 175442130) has the molecular formula C20H24FNO3
and a molecular weight of 345.41 g/mol. Its IUPAC name is ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate |
| PubChem CID | 175442130 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate |
| SMILES | C=CCN1C(=O)C(C)(CCC(=O)OCC)C(C)=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FNO3/c1-5-13-22-18(15-7-9-16(21)10-8-15)14(3)20(4,19(22)24)12-11-17(23)25-6-2/h5,7-10H,1,6,11-13H2,2-4H3 |
| InChIKey | UASPHBGGKLWJEB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate?
The IUPAC name of ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate (CID 175442130) is ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate.
What is the SMILES notation for ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate?
The canonical SMILES for ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate is C=CCN1C(=O)C(C)(CCC(=O)OCC)C(C)=C1c1ccc(F)cc1.
What is the InChIKey of ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate?
The InChIKey is UASPHBGGKLWJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24FNO3/c1-5-13-22-18(15-7-9-16(21)10-8-15)14(3)20(4,19(22)24)12-11-17(23)25-6-2/h5,7-10H,1,6,11-13H2,2-4H3.
What are the key properties of ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate?
ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate has a molecular weight of 345.41 g/mol, XLogP of 3.93, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[5-(4-fluorophenyl)-3,4-dimethyl-2-oxo-1-prop-2-enylpyrrol-3-yl]propanoate is sourced from PubChem (CID 175442130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).