C11H13IN2 — CID 175442270
2,5-dimethyl-1-phenylimidazole;hydroiodide (PubChem CID 175442270) has the molecular formula C11H13IN2 and a molecular weight of 300.14 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenylimidazole;hydroiodide.
| Compound Name | 2,5-dimethyl-1-phenylimidazole;hydroiodide |
|---|---|
| PubChem CID | 175442270 |
| Molecular Formula | C11H13IN2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2,5-dimethyl-1-phenylimidazole;hydroiodide |
| SMILES | Cc1cnc(C)n1-c1ccccc1.I |
| InChI | InChI=1S/C11H12N2.HI/c1-9-8-12-10(2)13(9)11-6-4-3-5-7-11;/h3-8H,1-2H3;1H |
| InChIKey | SHVJTFJALPNWHY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|