About 2,5-dimethyl-1-phenylimidazole;hydroiodide
2,5-dimethyl-1-phenylimidazole;hydroiodide (PubChem CID 175442270) has the molecular formula C11H13IN2
and a molecular weight of 300.14 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenylimidazole;hydroiodide.
Molecular Properties
| Compound Name | 2,5-dimethyl-1-phenylimidazole;hydroiodide |
| PubChem CID | 175442270 |
| Molecular Formula | C11H13IN2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2,5-dimethyl-1-phenylimidazole;hydroiodide |
| SMILES | Cc1cnc(C)n1-c1ccccc1.I |
| InChI | InChI=1S/C11H12N2.HI/c1-9-8-12-10(2)13(9)11-6-4-3-5-7-11;/h3-8H,1-2H3;1H |
| InChIKey | SHVJTFJALPNWHY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-1-phenylimidazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1-phenylimidazole;hydroiodide?
The IUPAC name of 2,5-dimethyl-1-phenylimidazole;hydroiodide (CID 175442270) is 2,5-dimethyl-1-phenylimidazole;hydroiodide.
What is the SMILES notation for 2,5-dimethyl-1-phenylimidazole;hydroiodide?
The canonical SMILES for 2,5-dimethyl-1-phenylimidazole;hydroiodide is Cc1cnc(C)n1-c1ccccc1.I.
What is the InChIKey of 2,5-dimethyl-1-phenylimidazole;hydroiodide?
The InChIKey is SHVJTFJALPNWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.HI/c1-9-8-12-10(2)13(9)11-6-4-3-5-7-11;/h3-8H,1-2H3;1H.
What are the key properties of 2,5-dimethyl-1-phenylimidazole;hydroiodide?
2,5-dimethyl-1-phenylimidazole;hydroiodide has a molecular weight of 300.14 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-phenylimidazole;hydroiodide is sourced from PubChem (CID 175442270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).