About 1-oxothietane-3,3-diol
1-oxothietane-3,3-diol (PubChem CID 175442478) has the molecular formula C3H6O3S
and a molecular weight of 122.14 g/mol. Its IUPAC name is 1-oxothietane-3,3-diol.
Molecular Properties
| Compound Name | 1-oxothietane-3,3-diol |
| PubChem CID | 175442478 |
| Molecular Formula | C3H6O3S |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.00 |
| IUPAC Name | 1-oxothietane-3,3-diol |
| SMILES | O=S1CC(O)(O)C1 |
| InChI | InChI=1S/C3H6O3S/c4-3(5)1-7(6)2-3/h4-5H,1-2H2 |
| InChIKey | OEGHTJXBPNVDLQ-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-oxothietane-3,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxothietane-3,3-diol?
The IUPAC name of 1-oxothietane-3,3-diol (CID 175442478) is 1-oxothietane-3,3-diol.
What is the SMILES notation for 1-oxothietane-3,3-diol?
The canonical SMILES for 1-oxothietane-3,3-diol is O=S1CC(O)(O)C1.
What is the InChIKey of 1-oxothietane-3,3-diol?
The InChIKey is OEGHTJXBPNVDLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3S/c4-3(5)1-7(6)2-3/h4-5H,1-2H2.
What are the key properties of 1-oxothietane-3,3-diol?
1-oxothietane-3,3-diol has a molecular weight of 122.14 g/mol, XLogP of -1.57, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxothietane-3,3-diol is sourced from PubChem (CID 175442478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).