C29H29FN2O9S2 — CID 175442760
N-[4-[3-(2-fluorophenyl)sulfonyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-3-yl]sulfonylphenyl]acetamide (PubChem CID 175442760) has the molecular formula C29H29FN2O9S2 and a molecular weight of 632.69 g/mol. Its IUPAC name is N-[4-[3-(2-fluorophenyl)sulfonyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-3-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[3-(2-fluorophenyl)sulfonyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-3-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 175442760 |
| Molecular Formula | C29H29FN2O9S2 |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | N-[4-[3-(2-fluorophenyl)sulfonyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]piperidin-3-yl]sulfonylphenyl]acetamide |
| SMILES | COc1cc(C=C2CNCC(S(=O)(=O)c3ccc(NC(C)=O)cc3)(S(=O)(=O)c3ccccc3F)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C29H29FN2O9S2/c1-18(33)32-21-9-11-22(12-10-21)42(35,36)29(43(37,38)26-8-6-5-7-23(26)30)17-31-16-20(28(29)34)13-19-14-24(39-2)27(41-4)25(15-19)40-3/h5-15,31H,16-17H2,1-4H3,(H,32,33) |
| InChIKey | YQRQQYZMTVCCIM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|