C22H24F3N3O3 — CID 175443386
N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-methoxy-7-(2-methoxyethoxy)-2-methylquinazolin-4-amine (PubChem CID 175443386) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-methoxy-7-(2-methoxyethoxy)-2-methylquinazolin-4-amine.
| Compound Name | N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-methoxy-7-(2-methoxyethoxy)-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 175443386 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-6-methoxy-7-(2-methoxyethoxy)-2-methylquinazolin-4-amine |
| SMILES | COCCOc1cc2nc(C)nc(NC(C)c3cccc(C(F)F)c3F)c2cc1OC |
| InChI | InChI=1S/C22H24F3N3O3/c1-12(14-6-5-7-15(20(14)23)21(24)25)26-22-16-10-18(30-4)19(31-9-8-29-3)11-17(16)27-13(2)28-22/h5-7,10-12,21H,8-9H2,1-4H3,(H,26,27,28) |
| InChIKey | KFQWJNYLBIVMCQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|