About 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid
3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid (PubChem CID 175443541) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid.
Molecular Properties
| Compound Name | 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid |
| PubChem CID | 175443541 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid |
| SMILES | CC=CC(C(=O)O)=C(C=C(C)C(=O)O)C1=CCCCC1 |
| InChI | InChI=1S/C16H20O4/c1-3-7-13(16(19)20)14(10-11(2)15(17)18)12-8-5-4-6-9-12/h3,7-8,10H,4-6,9H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | OAGQPIPHDGYERF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid?
The IUPAC name of 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid (CID 175443541) is 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid.
What is the SMILES notation for 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid?
The canonical SMILES for 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid is CC=CC(C(=O)O)=C(C=C(C)C(=O)O)C1=CCCCC1.
What is the InChIKey of 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid?
The InChIKey is OAGQPIPHDGYERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O4/c1-3-7-13(16(19)20)14(10-11(2)15(17)18)12-8-5-4-6-9-12/h3,7-8,10H,4-6,9H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid?
3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid has a molecular weight of 276.33 g/mol, XLogP of 3.47, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexen-1-yl)-5-methyl-2-prop-1-enylhexa-2,4-dienedioic acid is sourced from PubChem (CID 175443541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).