About 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine
4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine (PubChem CID 175443642) has the molecular formula C9H10ClN3S
and a molecular weight of 227.72 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine |
| PubChem CID | 175443642 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine |
| SMILES | NC1=NC(N)(c2cccc(Cl)c2)CS1 |
| InChI | InChI=1S/C9H10ClN3S/c10-7-3-1-2-6(4-7)9(12)5-14-8(11)13-9/h1-4H,5,12H2,(H2,11,13) |
| InChIKey | MKZTYYPZKIIXKT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine?
The IUPAC name of 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine (CID 175443642) is 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine.
What is the SMILES notation for 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine?
The canonical SMILES for 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine is NC1=NC(N)(c2cccc(Cl)c2)CS1.
What is the InChIKey of 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine?
The InChIKey is MKZTYYPZKIIXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3S/c10-7-3-1-2-6(4-7)9(12)5-14-8(11)13-9/h1-4H,5,12H2,(H2,11,13).
What are the key properties of 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine?
4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine has a molecular weight of 227.72 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-5H-1,3-thiazole-2,4-diamine is sourced from PubChem (CID 175443642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).