About sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride
sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride (PubChem CID 175443975) has the molecular formula C12H16NNaO7S
and a molecular weight of 341.32 g/mol. Its IUPAC name is sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride.
Molecular Properties
| Compound Name | sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride |
| PubChem CID | 175443975 |
| Molecular Formula | C12H16NNaO7S |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride |
| SMILES | O=C(O)C1CCC(CN2C(=O)C=CC2=O)C(S(=O)(=O)O)C1.[H-].[Na+] |
| InChI | InChI=1S/C12H15NO7S.Na.H/c14-10-3-4-11(15)13(10)6-8-2-1-7(12(16)17)5-9(8)21(18,19)20;;/h3-4,7-9H,1-2,5-6H2,(H,16,17)(H,18,19,20);;/q;+1;-1 |
| InChIKey | XFOJGSIKBSSIQM-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride?
The IUPAC name of sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride (CID 175443975) is sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride.
What is the SMILES notation for sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride?
The canonical SMILES for sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride is O=C(O)C1CCC(CN2C(=O)C=CC2=O)C(S(=O)(=O)O)C1.[H-].[Na+].
What is the InChIKey of sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride?
The InChIKey is XFOJGSIKBSSIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO7S.Na.H/c14-10-3-4-11(15)13(10)6-8-2-1-7(12(16)17)5-9(8)21(18,19)20;;/h3-4,7-9H,1-2,5-6H2,(H,16,17)(H,18,19,20);;/q;+1;-1.
What are the key properties of sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride?
sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride has a molecular weight of 341.32 g/mol, XLogP of -3.21, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-[(2,5-dioxopyrrol-1-yl)methyl]-3-sulfocyclohexane-1-carboxylic acid;hydride is sourced from PubChem (CID 175443975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).