C25H27N3O4 — CID 175444037
7-[4-(8-ethoxy-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butoxy]-1H-1,8-naphthyridin-2-one (PubChem CID 175444037) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 7-[4-(8-ethoxy-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butoxy]-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-[4-(8-ethoxy-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butoxy]-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 175444037 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 7-[4-(8-ethoxy-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-2-yl)butoxy]-1H-1,8-naphthyridin-2-one |
| SMILES | CCOc1cccc2c3c(oc12)CN(CCCCOc1ccc2ccc(=O)[nH]c2n1)CC3 |
| InChI | InChI=1S/C25H27N3O4/c1-2-30-20-7-5-6-19-18-12-14-28(16-21(18)32-24(19)20)13-3-4-15-31-23-11-9-17-8-10-22(29)26-25(17)27-23/h5-11H,2-4,12-16H2,1H3,(H,26,27,29) |
| InChIKey | MHJSCOUUJRIWGA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|