C10H21ClN2O2 — CID 175444438
(2S)-2-(aminomethyl)pyrrolidine-1-carboxylic acid;2-chloro-2-methylpropane (PubChem CID 175444438) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is (2S)-2-(aminomethyl)pyrrolidine-1-carboxylic acid;2-chloro-2-methylpropane.
| Compound Name | (2S)-2-(aminomethyl)pyrrolidine-1-carboxylic acid;2-chloro-2-methylpropane |
|---|---|
| PubChem CID | 175444438 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2S)-2-(aminomethyl)pyrrolidine-1-carboxylic acid;2-chloro-2-methylpropane |
| SMILES | CC(C)(C)Cl.NC[C@@H]1CCCN1C(=O)O |
| InChI | InChI=1S/C6H12N2O2.C4H9Cl/c7-4-5-2-1-3-8(5)6(9)10;1-4(2,3)5/h5H,1-4,7H2,(H,9,10);1-3H3/t5-;/m0./s1 |
| InChIKey | XDQADNXKUZYFEH-JEDNCBNOSA-N |
| XLogP | 2.11 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|