trimethyl-(3-methyl-3-silylbutyl)azanium chloride

C8H22ClNSi — CID 175444852

IUPACtrimethyl-(3-methyl-3-silylbutyl)azanium chloride
SMILESCC(C)([SiH3])CC[N+](C)(C)C.[Cl-]
InChIInChI=1S/C8H22NSi.ClH/c1-8(2,10)6-7-9(3,4)5;/h6-7H2,1-5,10H3;1H/q+1;/p-1
InChIKeyFEABPRSYMHCAAT-UHFFFAOYSA-M
MW195.81 g/mol
LogP-2.35
Rot. Bonds3

About trimethyl-(3-methyl-3-silylbutyl)azanium chloride

trimethyl-(3-methyl-3-silylbutyl)azanium chloride (PubChem CID 175444852) has the molecular formula C8H22ClNSi and a molecular weight of 195.81 g/mol. Its IUPAC name is trimethyl-(3-methyl-3-silylbutyl)azanium chloride.

Molecular Properties

Compound Nametrimethyl-(3-methyl-3-silylbutyl)azanium chloride
PubChem CID175444852
Molecular FormulaC8H22ClNSi
Molecular Weight195.81 g/mol
Exact Mass195.12
IUPAC Nametrimethyl-(3-methyl-3-silylbutyl)azanium chloride
SMILESCC(C)([SiH3])CC[N+](C)(C)C.[Cl-]
InChIInChI=1S/C8H22NSi.ClH/c1-8(2,10)6-7-9(3,4)5;/h6-7H2,1-5,10H3;1H/q+1;/p-1
InChIKeyFEABPRSYMHCAAT-UHFFFAOYSA-M
XLogP-2.35
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.81
LogP ≤ 5-2.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze trimethyl-(3-methyl-3-silylbutyl)azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethyl-(3-methyl-3-silylbutyl)azanium chloride?
The IUPAC name of trimethyl-(3-methyl-3-silylbutyl)azanium chloride (CID 175444852) is trimethyl-(3-methyl-3-silylbutyl)azanium chloride.
What is the SMILES notation for trimethyl-(3-methyl-3-silylbutyl)azanium chloride?
The canonical SMILES for trimethyl-(3-methyl-3-silylbutyl)azanium chloride is CC(C)([SiH3])CC[N+](C)(C)C.[Cl-].
What is the InChIKey of trimethyl-(3-methyl-3-silylbutyl)azanium chloride?
The InChIKey is FEABPRSYMHCAAT-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H22NSi.ClH/c1-8(2,10)6-7-9(3,4)5;/h6-7H2,1-5,10H3;1H/q+1;/p-1.
What are the key properties of trimethyl-(3-methyl-3-silylbutyl)azanium chloride?
trimethyl-(3-methyl-3-silylbutyl)azanium chloride has a molecular weight of 195.81 g/mol, XLogP of -2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(3-methyl-3-silylbutyl)azanium chloride is sourced from PubChem (CID 175444852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).