About methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one
methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one (PubChem CID 175444930) has the molecular formula C13H28N2O4S
and a molecular weight of 308.44 g/mol. Its IUPAC name is methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one |
| PubChem CID | 175444930 |
| Molecular Formula | C13H28N2O4S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one |
| SMILES | CN1CCC(=O)CC1.CN1CCCCC1.CS(=O)(=O)O |
| InChI | InChI=1S/C6H11NO.C6H13N.CH4O3S/c1-7-4-2-6(8)3-5-7;1-7-5-3-2-4-6-7;1-5(2,3)4/h2-5H2,1H3;2-6H2,1H3;1H3,(H,2,3,4) |
| InChIKey | VVAHWZYEXUQWBT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one?
The IUPAC name of methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one (CID 175444930) is methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one.
What is the SMILES notation for methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one?
The canonical SMILES for methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one is CN1CCC(=O)CC1.CN1CCCCC1.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one?
The InChIKey is VVAHWZYEXUQWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C6H13N.CH4O3S/c1-7-4-2-6(8)3-5-7;1-7-5-3-2-4-6-7;1-5(2,3)4/h2-5H2,1H3;2-6H2,1H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one?
methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one has a molecular weight of 308.44 g/mol, XLogP of 0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;1-methylpiperidine;1-methylpiperidin-4-one is sourced from PubChem (CID 175444930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).