C24H22BrF3N2O3S — CID 175444954
2-[3-[3-(3-bromopropoxy)-2-(trifluoromethyl)phenyl]-2-methylphenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylic acid (PubChem CID 175444954) has the molecular formula C24H22BrF3N2O3S and a molecular weight of 555.42 g/mol. Its IUPAC name is 2-[3-[3-(3-bromopropoxy)-2-(trifluoromethyl)phenyl]-2-methylphenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylic acid.
| Compound Name | 2-[3-[3-(3-bromopropoxy)-2-(trifluoromethyl)phenyl]-2-methylphenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 175444954 |
| Molecular Formula | C24H22BrF3N2O3S |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | 2-[3-[3-(3-bromopropoxy)-2-(trifluoromethyl)phenyl]-2-methylphenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylic acid |
| SMILES | Cc1c(-c2nc3c(s2)CN(C(=O)O)CC3)cccc1-c1cccc(OCCCBr)c1C(F)(F)F |
| InChI | InChI=1S/C24H22BrF3N2O3S/c1-14-15(17-7-3-8-19(33-12-4-10-25)21(17)24(26,27)28)5-2-6-16(14)22-29-18-9-11-30(23(31)32)13-20(18)34-22/h2-3,5-8H,4,9-13H2,1H3,(H,31,32) |
| InChIKey | WQZZINZGNUFWNW-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|