About 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one
2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one (PubChem CID 175445137) has the molecular formula C23H17NO8S2
and a molecular weight of 499.52 g/mol. Its IUPAC name is 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one.
Molecular Properties
| Compound Name | 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one |
| PubChem CID | 175445137 |
| Molecular Formula | C23H17NO8S2 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one |
| SMILES | Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1S(=O)(=O)O.O=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C13H8O.C10H9NO7S2/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;11-8-2-1-6-7(10(8)20(16,17)18)3-5(4-9(6)12)19(13,14)15/h1-8H;1-4,12H,11H2,(H,13,14,15)(H,16,17,18) |
| InChIKey | HSGBRXOCARYJNI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one?
The IUPAC name of 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one (CID 175445137) is 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one.
What is the SMILES notation for 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one?
The canonical SMILES for 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one is Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1S(=O)(=O)O.O=C1c2ccccc2-c2ccccc21.
What is the InChIKey of 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one?
The InChIKey is HSGBRXOCARYJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.C10H9NO7S2/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;11-8-2-1-6-7(10(8)20(16,17)18)3-5(4-9(6)12)19(13,14)15/h1-8H;1-4,12H,11H2,(H,13,14,15)(H,16,17,18).
What are the key properties of 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one?
2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one has a molecular weight of 499.52 g/mol, XLogP of 3.52, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-hydroxynaphthalene-1,7-disulfonic acid;fluoren-9-one is sourced from PubChem (CID 175445137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).