About sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione
sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione (PubChem CID 175445193) has the molecular formula C7H10NNaO2
and a molecular weight of 163.15 g/mol. Its IUPAC name is sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione |
| PubChem CID | 175445193 |
| Molecular Formula | C7H10NNaO2 |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione |
| SMILES | C=CCN1C(=O)CCC1=O.[H-].[Na+] |
| InChI | InChI=1S/C7H9NO2.Na.H/c1-2-5-8-6(9)3-4-7(8)10;;/h2H,1,3-5H2;;/q;+1;-1 |
| InChIKey | PEGWTRMDQORPLC-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione?
The IUPAC name of sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione (CID 175445193) is sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione.
What is the SMILES notation for sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione?
The canonical SMILES for sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione is C=CCN1C(=O)CCC1=O.[H-].[Na+].
What is the InChIKey of sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione?
The InChIKey is PEGWTRMDQORPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2.Na.H/c1-2-5-8-6(9)3-4-7(8)10;;/h2H,1,3-5H2;;/q;+1;-1.
What are the key properties of sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione?
sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione has a molecular weight of 163.15 g/mol, XLogP of -2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1-prop-2-enylpyrrolidine-2,5-dione is sourced from PubChem (CID 175445193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).