About 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde
6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 175445207) has the molecular formula C16H16F2O3
and a molecular weight of 294.30 g/mol. Its IUPAC name is 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 175445207 |
| Molecular Formula | C16H16F2O3 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCOCOC1C(F)=C(c2ccccc2)C=CC1(F)C=O |
| InChI | InChI=1S/C16H16F2O3/c1-2-20-11-21-15-14(17)13(8-9-16(15,18)10-19)12-6-4-3-5-7-12/h3-10,15H,2,11H2,1H3 |
| InChIKey | TYDLNYLJYJAORJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde (CID 175445207) is 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde is CCOCOC1C(F)=C(c2ccccc2)C=CC1(F)C=O.
What is the InChIKey of 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is TYDLNYLJYJAORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2O3/c1-2-20-11-21-15-14(17)13(8-9-16(15,18)10-19)12-6-4-3-5-7-12/h3-10,15H,2,11H2,1H3.
What are the key properties of 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde?
6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 294.30 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(ethoxymethoxy)-1,5-difluoro-4-phenylcyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 175445207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).