About 1-fluorocyclohexane-1,3-diol
1-fluorocyclohexane-1,3-diol (PubChem CID 175445441) has the molecular formula C6H11FO2
and a molecular weight of 134.15 g/mol. Its IUPAC name is 1-fluorocyclohexane-1,3-diol.
Molecular Properties
| Compound Name | 1-fluorocyclohexane-1,3-diol |
| PubChem CID | 175445441 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 1-fluorocyclohexane-1,3-diol |
| SMILES | OC1CCCC(O)(F)C1 |
| InChI | InChI=1S/C6H11FO2/c7-6(9)3-1-2-5(8)4-6/h5,8-9H,1-4H2 |
| InChIKey | IPJHWZJAKBCERZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluorocyclohexane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorocyclohexane-1,3-diol?
The IUPAC name of 1-fluorocyclohexane-1,3-diol (CID 175445441) is 1-fluorocyclohexane-1,3-diol.
What is the SMILES notation for 1-fluorocyclohexane-1,3-diol?
The canonical SMILES for 1-fluorocyclohexane-1,3-diol is OC1CCCC(O)(F)C1.
What is the InChIKey of 1-fluorocyclohexane-1,3-diol?
The InChIKey is IPJHWZJAKBCERZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO2/c7-6(9)3-1-2-5(8)4-6/h5,8-9H,1-4H2.
What are the key properties of 1-fluorocyclohexane-1,3-diol?
1-fluorocyclohexane-1,3-diol has a molecular weight of 134.15 g/mol, XLogP of 0.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorocyclohexane-1,3-diol is sourced from PubChem (CID 175445441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).