About 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate
2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate (PubChem CID 175446375) has the molecular formula C14H15F3N2O3
and a molecular weight of 316.28 g/mol. Its IUPAC name is 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate.
Molecular Properties
| Compound Name | 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate |
| PubChem CID | 175446375 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate |
| SMILES | O=CC(=O)OCCc1cnc(N2CCC(F)(F)CC2)c(F)c1 |
| InChI | InChI=1S/C14H15F3N2O3/c15-11-7-10(1-6-22-12(21)9-20)8-18-13(11)19-4-2-14(16,17)3-5-19/h7-9H,1-6H2 |
| InChIKey | CJUUJCBXBZAOQI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate?
The IUPAC name of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate (CID 175446375) is 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate.
What is the SMILES notation for 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate?
The canonical SMILES for 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate is O=CC(=O)OCCc1cnc(N2CCC(F)(F)CC2)c(F)c1.
What is the InChIKey of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate?
The InChIKey is CJUUJCBXBZAOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2O3/c15-11-7-10(1-6-22-12(21)9-20)8-18-13(11)19-4-2-14(16,17)3-5-19/h7-9H,1-6H2.
What are the key properties of 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate?
2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate has a molecular weight of 316.28 g/mol, XLogP of 1.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(4,4-difluoropiperidin-1-yl)-5-fluoro-3-pyridinyl]ethyl 2-oxoacetate is sourced from PubChem (CID 175446375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).