About hydron;phenazine
hydron;phenazine (PubChem CID 175446889) has the molecular formula C12H9N2+
and a molecular weight of 181.22 g/mol. Its IUPAC name is hydron;phenazine.
Molecular Properties
| Compound Name | hydron;phenazine |
| PubChem CID | 175446889 |
| Molecular Formula | C12H9N2+ |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | hydron;phenazine |
| SMILES | [H+].c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C12H8N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H/p+1 |
| InChIKey | PCNDJXKNXGMECE-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;phenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;phenazine?
The IUPAC name of hydron;phenazine (CID 175446889) is hydron;phenazine.
What is the SMILES notation for hydron;phenazine?
The canonical SMILES for hydron;phenazine is [H+].c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of hydron;phenazine?
The InChIKey is PCNDJXKNXGMECE-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H8N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-8H/p+1.
What are the key properties of hydron;phenazine?
hydron;phenazine has a molecular weight of 181.22 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;phenazine is sourced from PubChem (CID 175446889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).