About 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one
4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one (PubChem CID 175447818) has the molecular formula C13H18F4O3
and a molecular weight of 298.28 g/mol. Its IUPAC name is 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one.
Molecular Properties
| Compound Name | 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one |
| PubChem CID | 175447818 |
| Molecular Formula | C13H18F4O3 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one |
| SMILES | O=C(O)C1CCC(F)(F)CC1.O=C1CCC(F)C(F)C1 |
| InChI | InChI=1S/C7H10F2O2.C6H8F2O/c8-7(9)3-1-5(2-4-7)6(10)11;7-5-2-1-4(9)3-6(5)8/h5H,1-4H2,(H,10,11);5-6H,1-3H2 |
| InChIKey | SOYWIEGEAQOONO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one?
The IUPAC name of 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one (CID 175447818) is 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one.
What is the SMILES notation for 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one?
The canonical SMILES for 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one is O=C(O)C1CCC(F)(F)CC1.O=C1CCC(F)C(F)C1.
What is the InChIKey of 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one?
The InChIKey is SOYWIEGEAQOONO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O2.C6H8F2O/c8-7(9)3-1-5(2-4-7)6(10)11;7-5-2-1-4(9)3-6(5)8/h5H,1-4H2,(H,10,11);5-6H,1-3H2.
What are the key properties of 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one?
4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one has a molecular weight of 298.28 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorocyclohexane-1-carboxylic acid;3,4-difluorocyclohexan-1-one is sourced from PubChem (CID 175447818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).