C14H20O5 — CID 175447962
ethane-1,2-diol;6-(4-hydroxyphenyl)-6-oxohexanal (PubChem CID 175447962) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethane-1,2-diol;6-(4-hydroxyphenyl)-6-oxohexanal.
| Compound Name | ethane-1,2-diol;6-(4-hydroxyphenyl)-6-oxohexanal |
|---|---|
| PubChem CID | 175447962 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | ethane-1,2-diol;6-(4-hydroxyphenyl)-6-oxohexanal |
| SMILES | O=CCCCCC(=O)c1ccc(O)cc1.OCCO |
| InChI | InChI=1S/C12H14O3.C2H6O2/c13-9-3-1-2-4-12(15)10-5-7-11(14)8-6-10;3-1-2-4/h5-9,14H,1-4H2;3-4H,1-2H2 |
| InChIKey | JRCQQTONVLULAB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|