About 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid
2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid (PubChem CID 175448145) has the molecular formula C7H18N2O3S
and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid.
Molecular Properties
| Compound Name | 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid |
| PubChem CID | 175448145 |
| Molecular Formula | C7H18N2O3S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid |
| SMILES | CCC(C)(C)C(CS(=O)(=O)O)NN |
| InChI | InChI=1S/C7H18N2O3S/c1-4-7(2,3)6(9-8)5-13(10,11)12/h6,9H,4-5,8H2,1-3H3,(H,10,11,12) |
| InChIKey | JVCCWWUEEFJGDX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
The IUPAC name of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid (CID 175448145) is 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid.
What is the SMILES notation for 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
The canonical SMILES for 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid is CCC(C)(C)C(CS(=O)(=O)O)NN.
What is the InChIKey of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
The InChIKey is JVCCWWUEEFJGDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O3S/c1-4-7(2,3)6(9-8)5-13(10,11)12/h6,9H,4-5,8H2,1-3H3,(H,10,11,12).
What are the key properties of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid has a molecular weight of 210.30 g/mol, XLogP of 0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid is sourced from PubChem (CID 175448145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).