2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid

C7H18N2O3S — CID 175448145

IUPAC2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid
SMILESCCC(C)(C)C(CS(=O)(=O)O)NN
InChIInChI=1S/C7H18N2O3S/c1-4-7(2,3)6(9-8)5-13(10,11)12/h6,9H,4-5,8H2,1-3H3,(H,10,11,12)
InChIKeyJVCCWWUEEFJGDX-UHFFFAOYSA-N
MW210.30 g/mol
LogP0.14
Rot. Bonds5

About 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid

2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid (PubChem CID 175448145) has the molecular formula C7H18N2O3S and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid.

Molecular Properties

Compound Name2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid
PubChem CID175448145
Molecular FormulaC7H18N2O3S
Molecular Weight210.30 g/mol
Exact Mass210.10
IUPAC Name2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid
SMILESCCC(C)(C)C(CS(=O)(=O)O)NN
InChIInChI=1S/C7H18N2O3S/c1-4-7(2,3)6(9-8)5-13(10,11)12/h6,9H,4-5,8H2,1-3H3,(H,10,11,12)
InChIKeyJVCCWWUEEFJGDX-UHFFFAOYSA-N
XLogP0.14
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.30
LogP ≤ 50.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
The IUPAC name of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid (CID 175448145) is 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid.
What is the SMILES notation for 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
The canonical SMILES for 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid is CCC(C)(C)C(CS(=O)(=O)O)NN.
What is the InChIKey of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
The InChIKey is JVCCWWUEEFJGDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O3S/c1-4-7(2,3)6(9-8)5-13(10,11)12/h6,9H,4-5,8H2,1-3H3,(H,10,11,12).
What are the key properties of 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid?
2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid has a molecular weight of 210.30 g/mol, XLogP of 0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyl-3,3-dimethylpentane-1-sulfonic acid is sourced from PubChem (CID 175448145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).